C17H18F2N2O2S — CID 78828374
2,4-difluoro-N-(3-methyl-4-pyrrolidin-1-ylphenyl)benzenesulfonamide (PubChem CID 78828374) has the molecular formula C17H18F2N2O2S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2,4-difluoro-N-(3-methyl-4-pyrrolidin-1-ylphenyl)benzenesulfonamide.
| Compound Name | 2,4-difluoro-N-(3-methyl-4-pyrrolidin-1-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 78828374 |
| Molecular Formula | C17H18F2N2O2S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2,4-difluoro-N-(3-methyl-4-pyrrolidin-1-ylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(F)cc2F)ccc1N1CCCC1 |
| InChI | InChI=1S/C17H18F2N2O2S/c1-12-10-14(5-6-16(12)21-8-2-3-9-21)20-24(22,23)17-7-4-13(18)11-15(17)19/h4-7,10-11,20H,2-3,8-9H2,1H3 |
| InChIKey | BRNDQEQOSKNLNU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|