C18H12F4N2O2S — CID 112990183
4-fluoro-N-[4-(2,3,4-trifluoroanilino)phenyl]benzenesulfonamide (PubChem CID 112990183) has the molecular formula C18H12F4N2O2S and a molecular weight of 396.37 g/mol. Its IUPAC name is 4-fluoro-N-[4-(2,3,4-trifluoroanilino)phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-(2,3,4-trifluoroanilino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112990183 |
| Molecular Formula | C18H12F4N2O2S |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-fluoro-N-[4-(2,3,4-trifluoroanilino)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2ccc(F)c(F)c2F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H12F4N2O2S/c19-11-1-7-14(8-2-11)27(25,26)24-13-5-3-12(4-6-13)23-16-10-9-15(20)17(21)18(16)22/h1-10,23-24H |
| InChIKey | HLAUQVODHMSJJD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|