C14H8F7NO3S — CID 4984988
2,3,4-trifluoro-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide (PubChem CID 4984988) has the molecular formula C14H8F7NO3S and a molecular weight of 403.28 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4984988 |
| Molecular Formula | C14H8F7NO3S |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC(F)(F)C(F)F)cc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H8F7NO3S/c15-9-5-6-10(12(17)11(9)16)26(23,24)22-7-1-3-8(4-2-7)25-14(20,21)13(18)19/h1-6,13,22H |
| InChIKey | XCASXQHMPHKVKZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|