C14H9Cl2F4NO3S — CID 3861332
2,5-dichloro-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide (PubChem CID 3861332) has the molecular formula C14H9Cl2F4NO3S and a molecular weight of 418.20 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3861332 |
| Molecular Formula | C14H9Cl2F4NO3S |
| Molecular Weight | 418.20 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 2,5-dichloro-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(OC(F)(F)C(F)F)c1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H9Cl2F4NO3S/c15-8-4-5-11(16)12(6-8)25(22,23)21-9-2-1-3-10(7-9)24-14(19,20)13(17)18/h1-7,13,21H |
| InChIKey | HZQNVJVAYOUSRS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.20 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|