C20H15Cl2F2N3O2S3 — CID 3544385
1-[4-chloro-3-[(3-chlorophenyl)sulfamoyl]phenyl]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea (PubChem CID 3544385) has the molecular formula C20H15Cl2F2N3O2S3 and a molecular weight of 534.46 g/mol. Its IUPAC name is 1-[4-chloro-3-[(3-chlorophenyl)sulfamoyl]phenyl]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea.
| Compound Name | 1-[4-chloro-3-[(3-chlorophenyl)sulfamoyl]phenyl]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
|---|---|
| PubChem CID | 3544385 |
| Molecular Formula | C20H15Cl2F2N3O2S3 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 532.97 |
| IUPAC Name | 1-[4-chloro-3-[(3-chlorophenyl)sulfamoyl]phenyl]-3-[4-(difluoromethylsulfanyl)phenyl]thiourea |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1)c1cc(NC(=S)Nc2ccc(SC(F)F)cc2)ccc1Cl |
| InChI | InChI=1S/C20H15Cl2F2N3O2S3/c21-12-2-1-3-15(10-12)27-32(28,29)18-11-14(6-9-17(18)22)26-20(30)25-13-4-7-16(8-5-13)31-19(23)24/h1-11,19,27H,(H2,25,26,30) |
| InChIKey | SWOAXJVWBBBAQA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|