C23H24ClN3O2S2 — CID 4025966
1-[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 4025966) has the molecular formula C23H24ClN3O2S2 and a molecular weight of 474.05 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 4025966 |
| Molecular Formula | C23H24ClN3O2S2 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(C(C)C)cc2)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClN3O2S2/c1-15(2)17-5-10-19(11-6-17)25-23(30)26-21-9-4-16(3)22(14-21)31(28,29)27-20-12-7-18(24)8-13-20/h4-15,27H,1-3H3,(H2,25,26,30) |
| InChIKey | QXTNRWMTDOXQFL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|