C21H19F2N3O2S3 — CID 55353467
1-[4-(difluoromethylsulfanyl)phenyl]-3-[3-[methyl(phenyl)sulfamoyl]phenyl]thiourea (PubChem CID 55353467) has the molecular formula C21H19F2N3O2S3 and a molecular weight of 479.60 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[3-[methyl(phenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[3-[methyl(phenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 55353467 |
| Molecular Formula | C21H19F2N3O2S3 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[3-[methyl(phenyl)sulfamoyl]phenyl]thiourea |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=S)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C21H19F2N3O2S3/c1-26(17-7-3-2-4-8-17)31(27,28)19-9-5-6-16(14-19)25-21(29)24-15-10-12-18(13-11-15)30-20(22)23/h2-14,20H,1H3,(H2,24,25,29) |
| InChIKey | ZTGBMSHFHGNUMV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|