C14H10F4N2O5S — CID 3763224
2-nitro-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide (PubChem CID 3763224) has the molecular formula C14H10F4N2O5S and a molecular weight of 394.30 g/mol. Its IUPAC name is 2-nitro-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3763224 |
| Molecular Formula | C14H10F4N2O5S |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 2-nitro-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Nc1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C14H10F4N2O5S/c15-13(16)14(17,18)25-10-5-3-4-9(8-10)19-26(23,24)12-7-2-1-6-11(12)20(21)22/h1-8,13,19H |
| InChIKey | QXORTNKIOPZWCC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|