C17H9Br2F4NO4S — CID 2416762
(Z)-3-[2,4-bis(difluoromethoxy)phenyl]-2-(2,5-dibromophenyl)sulfonylprop-2-enenitrile (PubChem CID 2416762) has the molecular formula C17H9Br2F4NO4S and a molecular weight of 559.13 g/mol. Its IUPAC name is (Z)-3-[2,4-bis(difluoromethoxy)phenyl]-2-(2,5-dibromophenyl)sulfonylprop-2-enenitrile.
| Compound Name | (Z)-3-[2,4-bis(difluoromethoxy)phenyl]-2-(2,5-dibromophenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 2416762 |
| Molecular Formula | C17H9Br2F4NO4S |
| Molecular Weight | 559.13 g/mol |
| Exact Mass | 556.86 |
| IUPAC Name | (Z)-3-[2,4-bis(difluoromethoxy)phenyl]-2-(2,5-dibromophenyl)sulfonylprop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(OC(F)F)cc1OC(F)F)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C17H9Br2F4NO4S/c18-10-2-4-13(19)15(6-10)29(25,26)12(8-24)5-9-1-3-11(27-16(20)21)7-14(9)28-17(22)23/h1-7,16-17H/b12-5- |
| InChIKey | DKSKUGJKCNLYNZ-XGICHPGQSA-N |
| XLogP | 5.75 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.13 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|