C17H13Br2NO3S — CID 35770965
(E)-2-(2,5-dibromophenyl)sulfonyl-3-(4-ethoxyphenyl)prop-2-enenitrile (PubChem CID 35770965) has the molecular formula C17H13Br2NO3S and a molecular weight of 471.17 g/mol. Its IUPAC name is (E)-2-(2,5-dibromophenyl)sulfonyl-3-(4-ethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(2,5-dibromophenyl)sulfonyl-3-(4-ethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 35770965 |
| Molecular Formula | C17H13Br2NO3S |
| Molecular Weight | 471.17 g/mol |
| Exact Mass | 468.90 |
| IUPAC Name | (E)-2-(2,5-dibromophenyl)sulfonyl-3-(4-ethoxyphenyl)prop-2-enenitrile |
| SMILES | CCOc1ccc(/C=C(\C#N)S(=O)(=O)c2cc(Br)ccc2Br)cc1 |
| InChI | InChI=1S/C17H13Br2NO3S/c1-2-23-14-6-3-12(4-7-14)9-15(11-20)24(21,22)17-10-13(18)5-8-16(17)19/h3-10H,2H2,1H3/b15-9+ |
| InChIKey | UTGQVNIGNJSVAZ-OQLLNIDSSA-N |
| XLogP | 4.95 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|