C16H9Br2F2NO3S — CID 5214655
2-(2,5-dibromophenyl)sulfonyl-3-[2-(difluoromethoxy)phenyl]prop-2-enenitrile (PubChem CID 5214655) has the molecular formula C16H9Br2F2NO3S and a molecular weight of 493.12 g/mol. Its IUPAC name is 2-(2,5-dibromophenyl)sulfonyl-3-[2-(difluoromethoxy)phenyl]prop-2-enenitrile.
| Compound Name | 2-(2,5-dibromophenyl)sulfonyl-3-[2-(difluoromethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5214655 |
| Molecular Formula | C16H9Br2F2NO3S |
| Molecular Weight | 493.12 g/mol |
| Exact Mass | 490.86 |
| IUPAC Name | 2-(2,5-dibromophenyl)sulfonyl-3-[2-(difluoromethoxy)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1OC(F)F)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C16H9Br2F2NO3S/c17-11-5-6-13(18)15(8-11)25(22,23)12(9-21)7-10-3-1-2-4-14(10)24-16(19)20/h1-8,16H |
| InChIKey | ZNTZIESZQZRIKH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.12 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|