C15H8Br2FNO2S — CID 2436687
(E)-2-(2,5-dibromophenyl)sulfonyl-3-(2-fluorophenyl)prop-2-enenitrile (PubChem CID 2436687) has the molecular formula C15H8Br2FNO2S and a molecular weight of 445.11 g/mol. Its IUPAC name is (E)-2-(2,5-dibromophenyl)sulfonyl-3-(2-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(2,5-dibromophenyl)sulfonyl-3-(2-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2436687 |
| Molecular Formula | C15H8Br2FNO2S |
| Molecular Weight | 445.11 g/mol |
| Exact Mass | 442.86 |
| IUPAC Name | (E)-2-(2,5-dibromophenyl)sulfonyl-3-(2-fluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1F)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H8Br2FNO2S/c16-11-5-6-13(17)15(8-11)22(20,21)12(9-19)7-10-3-1-2-4-14(10)18/h1-8H/b12-7+ |
| InChIKey | RJGFSJFAJVHENE-KPKJPENVSA-N |
| XLogP | 4.69 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.11 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|