C19H12F4N2O5 — CID 16554500
4-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 16554500) has the molecular formula C19H12F4N2O5 and a molecular weight of 424.31 g/mol. Its IUPAC name is 4-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 16554500 |
| Molecular Formula | C19H12F4N2O5 |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 4-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(OC(F)F)cc1OC(F)F)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H12F4N2O5/c20-18(21)29-14-6-3-11(15(8-14)30-19(22)23)7-12(9-24)16(26)25-13-4-1-10(2-5-13)17(27)28/h1-8,18-19H,(H,25,26)(H,27,28)/b12-7+ |
| InChIKey | IGSYSIIDFCVLOW-KPKJPENVSA-N |
| XLogP | 4.13 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|