C19H14F4N2O4 — CID 27114089
(E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-cyano-N-(3-methoxyphenyl)prop-2-enamide (PubChem CID 27114089) has the molecular formula C19H14F4N2O4 and a molecular weight of 410.32 g/mol. Its IUPAC name is (E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-cyano-N-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-cyano-N-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27114089 |
| Molecular Formula | C19H14F4N2O4 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (E)-3-[2,4-bis(difluoromethoxy)phenyl]-2-cyano-N-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(NC(=O)/C(C#N)=C/c2ccc(OC(F)F)cc2OC(F)F)c1 |
| InChI | InChI=1S/C19H14F4N2O4/c1-27-14-4-2-3-13(8-14)25-17(26)12(10-24)7-11-5-6-15(28-18(20)21)9-16(11)29-19(22)23/h2-9,18-19H,1H3,(H,25,26)/b12-7+ |
| InChIKey | RJVSCIPWNDVWPC-KPKJPENVSA-N |
| XLogP | 4.44 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|