About N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide
N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide (PubChem CID 29099572) has the molecular formula C14H14Cl2N2O3S2
and a molecular weight of 393.32 g/mol. Its IUPAC name is N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide |
| PubChem CID | 29099572 |
| Molecular Formula | C14H14Cl2N2O3S2 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(NS(=O)(=O)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C14H14Cl2N2O3S2/c1-8(2)14(19)17-9-3-5-10(6-4-9)18-23(20,21)11-7-12(15)22-13(11)16/h3-8,18H,1-2H3,(H,17,19) |
| InChIKey | GTRLRXPRJKHFHL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide?
The IUPAC name of N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide (CID 29099572) is N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide.
What is the SMILES notation for N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide?
The canonical SMILES for N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide is CC(C)C(=O)Nc1ccc(NS(=O)(=O)c2cc(Cl)sc2Cl)cc1.
What is the InChIKey of N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide?
The InChIKey is GTRLRXPRJKHFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O3S2/c1-8(2)14(19)17-9-3-5-10(6-4-9)18-23(20,21)11-7-12(15)22-13(11)16/h3-8,18H,1-2H3,(H,17,19).
What are the key properties of N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide?
N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide has a molecular weight of 393.32 g/mol, XLogP of 4.45, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]-2-methylpropanamide is sourced from PubChem (CID 29099572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).