C12H9Cl2NO4S2 — CID 65345578
2-[3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]acetic acid (PubChem CID 65345578) has the molecular formula C12H9Cl2NO4S2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 2-[3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]acetic acid.
| Compound Name | 2-[3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 65345578 |
| Molecular Formula | C12H9Cl2NO4S2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 2-[3-[(2,5-dichlorothiophen-3-yl)sulfonylamino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(NS(=O)(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C12H9Cl2NO4S2/c13-10-6-9(12(14)20-10)21(18,19)15-8-3-1-2-7(4-8)5-11(16)17/h1-4,6,15H,5H2,(H,16,17) |
| InChIKey | SZCUTWSNIQWAQJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |