C11H9Cl2NO2S2 — CID 39791947
N-benzyl-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 39791947) has the molecular formula C11H9Cl2NO2S2 and a molecular weight of 322.24 g/mol. Its IUPAC name is N-benzyl-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-benzyl-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 39791947 |
| Molecular Formula | C11H9Cl2NO2S2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | N-benzyl-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H9Cl2NO2S2/c12-10-6-9(11(13)17-10)18(15,16)14-7-8-4-2-1-3-5-8/h1-6,14H,7H2 |
| InChIKey | CUQRABSDJHCMTR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |