C13H14ClN3O4S2 — CID 2817713
4-amino-3-N-benzyl-6-chlorobenzene-1,3-disulfonamide (PubChem CID 2817713) has the molecular formula C13H14ClN3O4S2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 4-amino-3-N-benzyl-6-chlorobenzene-1,3-disulfonamide.
| Compound Name | 4-amino-3-N-benzyl-6-chlorobenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 2817713 |
| Molecular Formula | C13H14ClN3O4S2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 4-amino-3-N-benzyl-6-chlorobenzene-1,3-disulfonamide |
| SMILES | Nc1cc(Cl)c(S(N)(=O)=O)cc1S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H14ClN3O4S2/c14-10-6-11(15)13(7-12(10)22(16,18)19)23(20,21)17-8-9-4-2-1-3-5-9/h1-7,17H,8,15H2,(H2,16,18,19) |
| InChIKey | PJWMRHGNJWNXFY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|