C7H8Cl2INO2S2 — CID 114504676
2,5-dichloro-N-(3-iodopropyl)thiophene-3-sulfonamide (PubChem CID 114504676) has the molecular formula C7H8Cl2INO2S2 and a molecular weight of 400.09 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-iodopropyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(3-iodopropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114504676 |
| Molecular Formula | C7H8Cl2INO2S2 |
| Molecular Weight | 400.09 g/mol |
| Exact Mass | 398.84 |
| IUPAC Name | 2,5-dichloro-N-(3-iodopropyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCCI)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H8Cl2INO2S2/c8-6-4-5(7(9)14-6)15(12,13)11-3-1-2-10/h4,11H,1-3H2 |
| InChIKey | LHIOEZDXNNKNNG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.09 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|