C6H7Cl2NO2S2 — CID 2805979
2,5-dichloro-N-ethylthiophene-3-sulfonamide (PubChem CID 2805979) has the molecular formula C6H7Cl2NO2S2 and a molecular weight of 260.17 g/mol. Its IUPAC name is 2,5-dichloro-N-ethylthiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-ethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 2805979 |
| Molecular Formula | C6H7Cl2NO2S2 |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 258.93 |
| IUPAC Name | 2,5-dichloro-N-ethylthiophene-3-sulfonamide |
| SMILES | CCNS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C6H7Cl2NO2S2/c1-2-9-13(10,11)4-3-5(7)12-6(4)8/h3,9H,2H2,1H3 |
| InChIKey | KQDQINTXQXTLDF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |