C9H11Cl2NO3S2 — CID 64993790
2,5-dichloro-N-(3-oxopentan-2-yl)thiophene-3-sulfonamide (PubChem CID 64993790) has the molecular formula C9H11Cl2NO3S2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-oxopentan-2-yl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(3-oxopentan-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 64993790 |
| Molecular Formula | C9H11Cl2NO3S2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 2,5-dichloro-N-(3-oxopentan-2-yl)thiophene-3-sulfonamide |
| SMILES | CCC(=O)C(C)NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H11Cl2NO3S2/c1-3-6(13)5(2)12-17(14,15)7-4-8(10)16-9(7)11/h4-5,12H,3H2,1-2H3 |
| InChIKey | KOGZYHHOMYNLQZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |