C8H10BrCl2NO2S2 — CID 114297747
N-(3-bromobutyl)-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 114297747) has the molecular formula C8H10BrCl2NO2S2 and a molecular weight of 367.12 g/mol. Its IUPAC name is N-(3-bromobutyl)-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-(3-bromobutyl)-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114297747 |
| Molecular Formula | C8H10BrCl2NO2S2 |
| Molecular Weight | 367.12 g/mol |
| Exact Mass | 364.87 |
| IUPAC Name | N-(3-bromobutyl)-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | CC(Br)CCNS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H10BrCl2NO2S2/c1-5(9)2-3-12-16(13,14)6-4-7(10)15-8(6)11/h4-5,12H,2-3H2,1H3 |
| InChIKey | HDSDXVOVUSMAJN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.12 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|