C7H10Cl2N2O4S3 — CID 61132382
2,5-dichloro-N-(3-sulfamoylpropyl)thiophene-3-sulfonamide (PubChem CID 61132382) has the molecular formula C7H10Cl2N2O4S3 and a molecular weight of 353.27 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-sulfamoylpropyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(3-sulfamoylpropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 61132382 |
| Molecular Formula | C7H10Cl2N2O4S3 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 351.92 |
| IUPAC Name | 2,5-dichloro-N-(3-sulfamoylpropyl)thiophene-3-sulfonamide |
| SMILES | NS(=O)(=O)CCCNS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C7H10Cl2N2O4S3/c8-6-4-5(7(9)16-6)18(14,15)11-2-1-3-17(10,12)13/h4,11H,1-3H2,(H2,10,12,13) |
| InChIKey | OZTPIDAQPRINDO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|