C12H12Cl2N2O3S2 — CID 61031745
N-[2-(4-aminophenoxy)ethyl]-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 61031745) has the molecular formula C12H12Cl2N2O3S2 and a molecular weight of 367.28 g/mol. Its IUPAC name is N-[2-(4-aminophenoxy)ethyl]-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-[2-(4-aminophenoxy)ethyl]-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 61031745 |
| Molecular Formula | C12H12Cl2N2O3S2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | N-[2-(4-aminophenoxy)ethyl]-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | Nc1ccc(OCCNS(=O)(=O)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C12H12Cl2N2O3S2/c13-11-7-10(12(14)20-11)21(17,18)16-5-6-19-9-3-1-8(15)2-4-9/h1-4,7,16H,5-6,15H2 |
| InChIKey | RUVONISGNNNIGQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|