C13H13Cl2NO4S2 — CID 34111661
2,5-dichloro-N-[2-(3-methoxyphenoxy)ethyl]thiophene-3-sulfonamide (PubChem CID 34111661) has the molecular formula C13H13Cl2NO4S2 and a molecular weight of 382.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(3-methoxyphenoxy)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-[2-(3-methoxyphenoxy)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 34111661 |
| Molecular Formula | C13H13Cl2NO4S2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 2,5-dichloro-N-[2-(3-methoxyphenoxy)ethyl]thiophene-3-sulfonamide |
| SMILES | COc1cccc(OCCNS(=O)(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C13H13Cl2NO4S2/c1-19-9-3-2-4-10(7-9)20-6-5-16-22(17,18)11-8-12(14)21-13(11)15/h2-4,7-8,16H,5-6H2,1H3 |
| InChIKey | IQNPPKTZVBRVJA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|