C13H11Cl2NO5S2 — CID 75404006
N-(2,5-dichlorothiophen-3-yl)sulfonyl-2-(3-methoxyphenoxy)acetamide (PubChem CID 75404006) has the molecular formula C13H11Cl2NO5S2 and a molecular weight of 396.27 g/mol. Its IUPAC name is N-(2,5-dichlorothiophen-3-yl)sulfonyl-2-(3-methoxyphenoxy)acetamide.
| Compound Name | N-(2,5-dichlorothiophen-3-yl)sulfonyl-2-(3-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 75404006 |
| Molecular Formula | C13H11Cl2NO5S2 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | N-(2,5-dichlorothiophen-3-yl)sulfonyl-2-(3-methoxyphenoxy)acetamide |
| SMILES | COc1cccc(OCC(=O)NS(=O)(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO5S2/c1-20-8-3-2-4-9(5-8)21-7-12(17)16-23(18,19)10-6-11(14)22-13(10)15/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | OZKFSLDAFJDUFJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |