C13H17NO5 — CID 82018109
methyl 3-[[2-(3-methoxyphenoxy)acetyl]amino]propanoate (PubChem CID 82018109) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 3-[[2-(3-methoxyphenoxy)acetyl]amino]propanoate.
| Compound Name | methyl 3-[[2-(3-methoxyphenoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 82018109 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl 3-[[2-(3-methoxyphenoxy)acetyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)COc1cccc(OC)c1 |
| InChI | InChI=1S/C13H17NO5/c1-17-10-4-3-5-11(8-10)19-9-12(15)14-7-6-13(16)18-2/h3-5,8H,6-7,9H2,1-2H3,(H,14,15) |
| InChIKey | QWACAHNVDPFHDE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |