C18H22ClNO4S — CID 113103104
N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-methoxy-2-methylbenzenesulfonamide (PubChem CID 113103104) has the molecular formula C18H22ClNO4S and a molecular weight of 383.90 g/mol. Its IUPAC name is N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-methoxy-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-methoxy-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113103104 |
| Molecular Formula | C18H22ClNO4S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-methoxy-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCOc2cc(C)c(Cl)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C18H22ClNO4S/c1-12-9-15(23-4)5-6-17(12)25(21,22)20-7-8-24-16-10-13(2)18(19)14(3)11-16/h5-6,9-11,20H,7-8H2,1-4H3 |
| InChIKey | BWMZEETYLQLQEA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|