C13H14ClNO4S — CID 110732049
N-[(5-chlorofuran-2-yl)methyl]-4-methoxy-2-methylbenzenesulfonamide (PubChem CID 110732049) has the molecular formula C13H14ClNO4S and a molecular weight of 315.78 g/mol. Its IUPAC name is N-[(5-chlorofuran-2-yl)methyl]-4-methoxy-2-methylbenzenesulfonamide.
| Compound Name | N-[(5-chlorofuran-2-yl)methyl]-4-methoxy-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110732049 |
| Molecular Formula | C13H14ClNO4S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[(5-chlorofuran-2-yl)methyl]-4-methoxy-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(Cl)o2)c(C)c1 |
| InChI | InChI=1S/C13H14ClNO4S/c1-9-7-10(18-2)3-5-12(9)20(16,17)15-8-11-4-6-13(14)19-11/h3-7,15H,8H2,1-2H3 |
| InChIKey | DFCBUOCJODTKMM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |