C17H20ClNO2 — CID 54796773
N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-methoxyaniline (PubChem CID 54796773) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-methoxyaniline.
| Compound Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 54796773 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCCOc2cc(C)c(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C17H20ClNO2/c1-12-10-16(11-13(2)17(12)18)21-9-8-19-14-4-6-15(20-3)7-5-14/h4-7,10-11,19H,8-9H2,1-3H3 |
| InChIKey | BIZNCVQIKGRCPY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|