C9H13Cl2NO3S2 — CID 107319312
2,5-dichloro-N-(5-hydroxypentyl)thiophene-3-sulfonamide (PubChem CID 107319312) has the molecular formula C9H13Cl2NO3S2 and a molecular weight of 318.25 g/mol. Its IUPAC name is 2,5-dichloro-N-(5-hydroxypentyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(5-hydroxypentyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 107319312 |
| Molecular Formula | C9H13Cl2NO3S2 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 2,5-dichloro-N-(5-hydroxypentyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCCCCO)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H13Cl2NO3S2/c10-8-6-7(9(11)16-8)17(14,15)12-4-2-1-3-5-13/h6,12-13H,1-5H2 |
| InChIKey | ISJLIPQQZFFOIC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|