C10H16Cl2N2O2S2 — CID 43606292
N-(2-amino-4-methylpentyl)-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 43606292) has the molecular formula C10H16Cl2N2O2S2 and a molecular weight of 331.29 g/mol. Its IUPAC name is N-(2-amino-4-methylpentyl)-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-(2-amino-4-methylpentyl)-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 43606292 |
| Molecular Formula | C10H16Cl2N2O2S2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-(2-amino-4-methylpentyl)-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | CC(C)CC(N)CNS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H16Cl2N2O2S2/c1-6(2)3-7(13)5-14-18(15,16)8-4-9(11)17-10(8)12/h4,6-7,14H,3,5,13H2,1-2H3 |
| InChIKey | LWRSMFDRGAXSFW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |