C13H13Cl2NO2S2 — CID 55365000
2,5-dichloro-N-(2-phenylpropyl)thiophene-3-sulfonamide (PubChem CID 55365000) has the molecular formula C13H13Cl2NO2S2 and a molecular weight of 350.29 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-phenylpropyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(2-phenylpropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 55365000 |
| Molecular Formula | C13H13Cl2NO2S2 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 2,5-dichloro-N-(2-phenylpropyl)thiophene-3-sulfonamide |
| SMILES | CC(CNS(=O)(=O)c1cc(Cl)sc1Cl)c1ccccc1 |
| InChI | InChI=1S/C13H13Cl2NO2S2/c1-9(10-5-3-2-4-6-10)8-16-20(17,18)11-7-12(14)19-13(11)15/h2-7,9,16H,8H2,1H3 |
| InChIKey | BVPCIYNLGDEJJZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |