C11H10Cl2N2O2S2 — CID 4657628
2,5-dichloro-N-(2-pyridin-2-ylethyl)thiophene-3-sulfonamide (PubChem CID 4657628) has the molecular formula C11H10Cl2N2O2S2 and a molecular weight of 337.25 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-pyridin-2-ylethyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(2-pyridin-2-ylethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 4657628 |
| Molecular Formula | C11H10Cl2N2O2S2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2,5-dichloro-N-(2-pyridin-2-ylethyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccccn1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O2S2/c12-10-7-9(11(13)18-10)19(16,17)15-6-4-8-3-1-2-5-14-8/h1-3,5,7,15H,4,6H2 |
| InChIKey | ZWYOSMISOCOHGK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |