C12H13ClN4O2S — CID 64607542
6-amino-5-chloro-N-(2-pyridin-2-ylethyl)pyridine-3-sulfonamide (PubChem CID 64607542) has the molecular formula C12H13ClN4O2S and a molecular weight of 312.78 g/mol. Its IUPAC name is 6-amino-5-chloro-N-(2-pyridin-2-ylethyl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-(2-pyridin-2-ylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607542 |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 6-amino-5-chloro-N-(2-pyridin-2-ylethyl)pyridine-3-sulfonamide |
| SMILES | Nc1ncc(S(=O)(=O)NCCc2ccccn2)cc1Cl |
| InChI | InChI=1S/C12H13ClN4O2S/c13-11-7-10(8-16-12(11)14)20(18,19)17-6-4-9-3-1-2-5-15-9/h1-3,5,7-8,17H,4,6H2,(H2,14,16) |
| InChIKey | VWACJGHXJZLIAD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |