C21H16N2O4S — CID 3694272
9,10-dioxo-N-(2-pyridin-2-ylethyl)anthracene-2-sulfonamide (PubChem CID 3694272) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 9,10-dioxo-N-(2-pyridin-2-ylethyl)anthracene-2-sulfonamide.
| Compound Name | 9,10-dioxo-N-(2-pyridin-2-ylethyl)anthracene-2-sulfonamide |
|---|---|
| PubChem CID | 3694272 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 9,10-dioxo-N-(2-pyridin-2-ylethyl)anthracene-2-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)NCCc3ccccn3)ccc21 |
| InChI | InChI=1S/C21H16N2O4S/c24-20-16-6-1-2-7-17(16)21(25)19-13-15(8-9-18(19)20)28(26,27)23-12-10-14-5-3-4-11-22-14/h1-9,11,13,23H,10,12H2 |
| InChIKey | AKJZWEDXMSTMHE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|