C16H13NO4S — CID 16832109
N-ethyl-9,10-dioxoanthracene-2-sulfonamide (PubChem CID 16832109) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-ethyl-9,10-dioxoanthracene-2-sulfonamide.
| Compound Name | N-ethyl-9,10-dioxoanthracene-2-sulfonamide |
|---|---|
| PubChem CID | 16832109 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | N-ethyl-9,10-dioxoanthracene-2-sulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H13NO4S/c1-2-17-22(20,21)10-7-8-13-14(9-10)16(19)12-6-4-3-5-11(12)15(13)18/h3-9,17H,2H2,1H3 |
| InChIKey | UUPNXGUFEOXHEL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|