C14H6O8S2-2 — CID 3731589
9,10-dioxoanthracene-2,7-disulfonate (PubChem CID 3731589) has the molecular formula C14H6O8S2-2 and a molecular weight of 366.33 g/mol. Its IUPAC name is 9,10-dioxoanthracene-2,7-disulfonate.
| Compound Name | 9,10-dioxoanthracene-2,7-disulfonate |
|---|---|
| PubChem CID | 3731589 |
| Molecular Formula | C14H6O8S2-2 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 9,10-dioxoanthracene-2,7-disulfonate |
| SMILES | O=C1c2ccc(S(=O)(=O)[O-])cc2C(=O)c2cc(S(=O)(=O)[O-])ccc21 |
| InChI | InChI=1S/C14H8O8S2/c15-13-9-3-1-7(23(17,18)19)5-11(9)14(16)12-6-8(24(20,21)22)2-4-10(12)13/h1-6H,(H,17,18,19)(H,20,21,22)/p-2 |
| InChIKey | OKONMFPEKSWGEU-UHFFFAOYSA-L |
| XLogP | 0.27 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|