C16H6N2Na2O8S2 — CID 172846316
disodium;3-oxo-2-(3-oxo-5-sulfonatoindol-2-yl)indole-5-sulfonate (PubChem CID 172846316) has the molecular formula C16H6N2Na2O8S2 and a molecular weight of 464.34 g/mol. Its IUPAC name is disodium;3-oxo-2-(3-oxo-5-sulfonatoindol-2-yl)indole-5-sulfonate.
| Compound Name | disodium;3-oxo-2-(3-oxo-5-sulfonatoindol-2-yl)indole-5-sulfonate |
|---|---|
| PubChem CID | 172846316 |
| Molecular Formula | C16H6N2Na2O8S2 |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | disodium;3-oxo-2-(3-oxo-5-sulfonatoindol-2-yl)indole-5-sulfonate |
| SMILES | O=C1C(C2=Nc3ccc(S(=O)(=O)[O-])cc3C2=O)=Nc2ccc(S(=O)(=O)[O-])cc21.[Na+].[Na+] |
| InChI | InChI=1S/C16H8N2O8S2.2Na/c19-15-9-5-7(27(21,22)23)1-3-11(9)17-13(15)14-16(20)10-6-8(28(24,25)26)2-4-12(10)18-14;;/h1-6H,(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2 |
| InChIKey | XLWNBYUGNMTGDZ-UHFFFAOYSA-L |
| XLogP | -5.26 |
| TPSA | 173.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | -5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|