C16H10N2O5S2 — CID 175027656
2-(3-hydroxy-5-sulfanylidene-1,4-dihydroindol-2-yl)-3-oxoindole-5-sulfonic acid (PubChem CID 175027656) has the molecular formula C16H10N2O5S2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-(3-hydroxy-5-sulfanylidene-1,4-dihydroindol-2-yl)-3-oxoindole-5-sulfonic acid.
| Compound Name | 2-(3-hydroxy-5-sulfanylidene-1,4-dihydroindol-2-yl)-3-oxoindole-5-sulfonic acid |
|---|---|
| PubChem CID | 175027656 |
| Molecular Formula | C16H10N2O5S2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 2-(3-hydroxy-5-sulfanylidene-1,4-dihydroindol-2-yl)-3-oxoindole-5-sulfonic acid |
| SMILES | O=C1C(c2[nH]c3c(c2O)CC(=S)C=C3)=Nc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C16H10N2O5S2/c19-15-9-5-7(24)1-3-11(9)17-13(15)14-16(20)10-6-8(25(21,22)23)2-4-12(10)18-14/h1-4,6,17,19H,5H2,(H,21,22,23) |
| InChIKey | UMSKHFDOVKTCSS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|