C16H10N2O8S3 — CID 146368243
3-hydroxy-2-(3-oxo-5-sulfoindol-2-yl)-7-sulfanyl-1H-indole-5-sulfonic acid (PubChem CID 146368243) has the molecular formula C16H10N2O8S3 and a molecular weight of 454.46 g/mol. Its IUPAC name is 3-hydroxy-2-(3-oxo-5-sulfoindol-2-yl)-7-sulfanyl-1H-indole-5-sulfonic acid.
| Compound Name | 3-hydroxy-2-(3-oxo-5-sulfoindol-2-yl)-7-sulfanyl-1H-indole-5-sulfonic acid |
|---|---|
| PubChem CID | 146368243 |
| Molecular Formula | C16H10N2O8S3 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 3-hydroxy-2-(3-oxo-5-sulfoindol-2-yl)-7-sulfanyl-1H-indole-5-sulfonic acid |
| SMILES | O=C1C(c2[nH]c3c(S)cc(S(=O)(=O)O)cc3c2O)=Nc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C16H10N2O8S3/c19-15-8-3-6(28(21,22)23)1-2-10(8)17-13(15)14-16(20)9-4-7(29(24,25)26)5-11(27)12(9)18-14/h1-5,18,20,27H,(H,21,22,23)(H,24,25,26) |
| InChIKey | KJWQEIZUADXAQE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 174.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|