C24H26N2O2 — CID 135581724
6-tert-butyl-2-(6-tert-butyl-3-hydroxy-1H-indol-2-yl)indol-3-one (PubChem CID 135581724) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 6-tert-butyl-2-(6-tert-butyl-3-hydroxy-1H-indol-2-yl)indol-3-one.
| Compound Name | 6-tert-butyl-2-(6-tert-butyl-3-hydroxy-1H-indol-2-yl)indol-3-one |
|---|---|
| PubChem CID | 135581724 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 6-tert-butyl-2-(6-tert-butyl-3-hydroxy-1H-indol-2-yl)indol-3-one |
| SMILES | CC(C)(C)c1ccc2c(c1)N=C(c1[nH]c3cc(C(C)(C)C)ccc3c1O)C2=O |
| InChI | InChI=1S/C24H26N2O2/c1-23(2,3)13-7-9-15-17(11-13)25-19(21(15)27)20-22(28)16-10-8-14(24(4,5)6)12-18(16)26-20/h7-12,25,27H,1-6H3 |
| InChIKey | CJRLIWVMXYKHPZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |