C16H10N2O8S2 — CID 136632797
2-(3-hydroxy-6-sulfo-1H-indol-2-yl)-3-oxoindole-6-sulfonic acid (PubChem CID 136632797) has the molecular formula C16H10N2O8S2 and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-(3-hydroxy-6-sulfo-1H-indol-2-yl)-3-oxoindole-6-sulfonic acid.
| Compound Name | 2-(3-hydroxy-6-sulfo-1H-indol-2-yl)-3-oxoindole-6-sulfonic acid |
|---|---|
| PubChem CID | 136632797 |
| Molecular Formula | C16H10N2O8S2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2-(3-hydroxy-6-sulfo-1H-indol-2-yl)-3-oxoindole-6-sulfonic acid |
| SMILES | O=C1C(c2[nH]c3cc(S(=O)(=O)O)ccc3c2O)=Nc2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C16H10N2O8S2/c19-15-9-3-1-7(27(21,22)23)5-11(9)17-13(15)14-16(20)10-4-2-8(28(24,25)26)6-12(10)18-14/h1-6,17,19H,(H,21,22,23)(H,24,25,26) |
| InChIKey | AVMKKKNJFGMFPN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 174.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|