C16H10N2O2 — CID 10215
2-(3-hydroxy-1H-indol-2-yl)indol-3-one (PubChem CID 10215) has the molecular formula C16H10N2O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-(3-hydroxy-1H-indol-2-yl)indol-3-one.
| Compound Name | 2-(3-hydroxy-1H-indol-2-yl)indol-3-one |
|---|---|
| PubChem CID | 10215 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-(3-hydroxy-1H-indol-2-yl)indol-3-one |
| SMILES | O=C1C(c2[nH]c3ccccc3c2O)=Nc2ccccc21 |
| InChI | InChI=1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17,19H |
| InChIKey | QQILFGKZUJYXGS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |