C11H7N3O3 — CID 3843472
2-(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)indol-3-one (PubChem CID 3843472) has the molecular formula C11H7N3O3 and a molecular weight of 229.19 g/mol. Its IUPAC name is 2-(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)indol-3-one.
| Compound Name | 2-(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)indol-3-one |
|---|---|
| PubChem CID | 3843472 |
| Molecular Formula | C11H7N3O3 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-(5-hydroxy-2-oxo-1,3-dihydroimidazol-4-yl)indol-3-one |
| SMILES | O=C1C(c2[nH]c(=O)[nH]c2O)=Nc2ccccc21 |
| InChI | InChI=1S/C11H7N3O3/c15-9-5-3-1-2-4-6(5)12-7(9)8-10(16)14-11(17)13-8/h1-4,16H,(H2,13,14,17) |
| InChIKey | HIUBHJCUIUYDJH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |