About 2-octylquinoline-3,4-dione
2-octylquinoline-3,4-dione (PubChem CID 75580776) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-octylquinoline-3,4-dione.
Molecular Properties
| Compound Name | 2-octylquinoline-3,4-dione |
| PubChem CID | 75580776 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-octylquinoline-3,4-dione |
| SMILES | CCCCCCCCC1=Nc2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C17H21NO2/c1-2-3-4-5-6-7-12-15-17(20)16(19)13-10-8-9-11-14(13)18-15/h8-11H,2-7,12H2,1H3 |
| InChIKey | WOTODGDVWXJDFS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-octylquinoline-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylquinoline-3,4-dione?
The IUPAC name of 2-octylquinoline-3,4-dione (CID 75580776) is 2-octylquinoline-3,4-dione.
What is the SMILES notation for 2-octylquinoline-3,4-dione?
The canonical SMILES for 2-octylquinoline-3,4-dione is CCCCCCCCC1=Nc2ccccc2C(=O)C1=O.
What is the InChIKey of 2-octylquinoline-3,4-dione?
The InChIKey is WOTODGDVWXJDFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2/c1-2-3-4-5-6-7-12-15-17(20)16(19)13-10-8-9-11-14(13)18-15/h8-11H,2-7,12H2,1H3.
What are the key properties of 2-octylquinoline-3,4-dione?
2-octylquinoline-3,4-dione has a molecular weight of 271.36 g/mol, XLogP of 4.28, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylquinoline-3,4-dione is sourced from PubChem (CID 75580776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).