C16H17NOS — CID 102468423
1-hexylthieno[2,3-b]indol-2-one (PubChem CID 102468423) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is 1-hexylthieno[2,3-b]indol-2-one.
| Compound Name | 1-hexylthieno[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 102468423 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-hexylthieno[2,3-b]indol-2-one |
| SMILES | CCCCCCC1=C2C(=Nc3ccccc32)SC1=O |
| InChI | InChI=1S/C16H17NOS/c1-2-3-4-5-9-12-14-11-8-6-7-10-13(11)17-15(14)19-16(12)18/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | KAPLTKBNJISSBB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|