C17H22O — CID 10657817
2,3-dibutylinden-1-one (PubChem CID 10657817) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,3-dibutylinden-1-one.
| Compound Name | 2,3-dibutylinden-1-one |
|---|---|
| PubChem CID | 10657817 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2,3-dibutylinden-1-one |
| SMILES | CCCCC1=C(CCCC)c2ccccc2C1=O |
| InChI | InChI=1S/C17H22O/c1-3-5-9-13-14-11-7-8-12-16(14)17(18)15(13)10-6-4-2/h7-8,11-12H,3-6,9-10H2,1-2H3 |
| InChIKey | HAKYVCDRJQIACS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |