C14H14O2S — CID 175119987
2-butyl-3-sulfanylnaphthalene-1,4-dione (PubChem CID 175119987) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-butyl-3-sulfanylnaphthalene-1,4-dione.
| Compound Name | 2-butyl-3-sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 175119987 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-butyl-3-sulfanylnaphthalene-1,4-dione |
| SMILES | CCCCC1=C(S)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H14O2S/c1-2-3-6-11-12(15)9-7-4-5-8-10(9)13(16)14(11)17/h4-5,7-8,17H,2-3,6H2,1H3 |
| InChIKey | PTOVJXHESJOMDI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|