C19H18O2S — CID 70467498
2-pentyl-1-sulfanylanthracene-9,10-dione (PubChem CID 70467498) has the molecular formula C19H18O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-pentyl-1-sulfanylanthracene-9,10-dione.
| Compound Name | 2-pentyl-1-sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 70467498 |
| Molecular Formula | C19H18O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-pentyl-1-sulfanylanthracene-9,10-dione |
| SMILES | CCCCCc1ccc2c(c1S)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H18O2S/c1-2-3-4-7-12-10-11-15-16(19(12)22)18(21)14-9-6-5-8-13(14)17(15)20/h5-6,8-11,22H,2-4,7H2,1H3 |
| InChIKey | LYIDUYUCQZYSAK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|